DMDNB

title: "DMDNB" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["explosive-chemicals", "nitro-compounds", "explosive-detection"] topic_path: "general/explosive-chemicals" source: "https://en.wikipedia.org/wiki/DMDNB" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Reference = | ImageFile = 2,3-dimethyl-2,3-dinitrobutane-2D-skeletal.png | ImageSize = 160px | ImageFile1 = DMDNB-3D-balls.png | ImageSize1 = 160px | PIN = 2,3-Dimethyl-2,3-dinitrobutane | OtherNames = 2,3-Dimethyl-2,3-dinitro-n-butane, DMDNB, DMNB |Section1={{Chembox Identifiers | ChemSpiderID = 69982 | InChIKey = DWCLXOREGBLXTD-UHFFFAOYAA | CASNo = 3964-18-9 | PubChem = 77577 | SMILES = CC(C)(C(C)(C)N+[O-])N+[O-] | InChI = 1/C6H12N2O4/c1-5(2,7(9)10)6(3,4)8(11)12/h1-4H3 |Section2={{Chembox Properties | C=6 | H=12 | N=2 | O=4 | Appearance = | Density = | MeltingPtC = 210 to 214 | MeltingPt_notes = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =
DMDNB, or also DMNB, chemically 2,3-dimethyl-2,3-dinitrobutane, is a volatile organic compound used as a detection taggant for explosives, mostly in the United States where it is virtually the only such taggant in use. Dogs are very sensitive to it and can detect as little as 0.5 parts per billion in the air, as can specialised ion mobility spectrometers. Its presence allows more reliable explosive detection.
References
References
- [http://www.orionchem.com/DMNB.htm Orion Chem PVT LTD Manufacture Information]
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::