DIPAMP
title: "DIPAMP" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["diphosphines", "hydrogenation-catalysts", "phenyl-compounds", "2-methoxyphenyl-compounds"] topic_path: "general/diphosphines" source: "https://en.wikipedia.org/wiki/DIPAMP" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedfields = changed | verifiedrevid = 477166314 | ImageFileL1 = DIPAMP.svg | ImageSizeL1 = 200 | ImageFileR1 = DIPAMP-from-xtal-2004-Mercury-3D-balls.png | ImageSizeR1 = 200 | PIN = (Ethane-1,2-diyl)bis[(2-methoxyphenyl)(phenyl)phosphane] | OtherNames = |Section1={{Chembox Identifiers | index1_label = (R,R) | index2_label = (S,S) | index3_label = (R,S) | CASNo = 63589-61-7 | CASNo1 = 55739-58-7 | CASNo2 = 97858-62-3 | ChemSpiderID = 2016305 | ChemSpiderID1 = 9060243 | ChemSpiderID2 = 9594634 | ChemSpiderID3 = 9910039 | PubChem = 2734557 | PubChem1 = 10884975 | PubChem2 = 11419748 | PubChem3 = 11735331 | SMILES = COc1ccccc1P(CCP(c2ccccc2)c3ccccc3OC)c4ccccc4 | SMILES1 = COc1ccccc1P@c4ccccc4 | SMILES2 = COc1ccccc1P@@c4ccccc4 | SMILES3 = O(c1ccccc1P@@CCP@@c4ccccc4OC)C | Jmol = none | StdInChI = 1S/C28H28O2P2/c1-29-25-17-9-11-19-27(25)31(23-13-5-3-6-14-23)21-22-32(24-15-7-4-8-16-24)28-20-12-10-18-26(28)30-2/h3-20H,21-22H2,1-2H3 | StdInChIKey = QKZWXPLBVCKXNQ-UHFFFAOYSA-N | InChI1 = 1S/C28H28O2P2/c1-29-25-17-9-11-19-27(25)31(23-13-5-3-6-14-23)21-22-32(24-15-7-4-8-16-24)28-20-12-10-18-26(28)30-2/h3-20H,21-22H2,1-2H3/t31-,32-/m1/s1 | InChIKey1 = QKZWXPLBVCKXNQ-ROJLCIKYSA-N | InChI2 = 1S/C28H28O2P2/c1-29-25-17-9-11-19-27(25)31(23-13-5-3-6-14-23)21-22-32(24-15-7-4-8-16-24)28-20-12-10-18-26(28)30-2/h3-20H,21-22H2,1-2H3/t31-,32-/m0/s1 | InChIKey2 = QKZWXPLBVCKXNQ-ACHIHNKUSA-N | InChI3 = 1S/C28H28O2P2/c1-29-25-17-9-11-19-27(25)31(23-13-5-3-6-14-23)21-22-32(24-15-7-4-8-16-24)28-20-12-10-18-26(28)30-2/h3-20H,21-22H2,1-2H3/t31-,32+ | InChIKey3 = QKZWXPLBVCKXNQ-MEKGRNQZSA-N | UNII1 = BLJ831OWLW | UNII2 = HS6F5EW3U6 |Section2={{Chembox Properties | C=28 | H=28 | O=2 | P=2 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =
DIPAMP is an organophosphorus compound that is used as a ligand in homogeneous catalysis. It is a white solid that dissolves in organic solvents. Work on this compound by W. S. Knowles was recognized with the Nobel Prize in Chemistry. DIPAMP was the basis for one of the first industrial scale asymmetric hydrogenation, the synthesis of the drug L-DOPA. :[[File:L-dopaSyn.svg|thumb|center|550px|Synthesis of L-DOPA via hydrogenation with the [[C2-Symmetric ligands|C2-symmetric diphosphine]] DIPAMP.]]
DIPAMP is a C2-symmetric diphosphine. Each phosphorus centre, which is pyramidal, bears three different substituents - anisyl, phenyl, and the ethylene group. The ligand therefore exists as the enantiomeric (R,R) and (S,S) pair, as well as the achiral meso isomer.
DIPAMP was originally prepared by an oxidative coupling, starting from anisyl(phenyl)(methyl)phosphine.
::figure[src="https://upload.wikimedia.org/wikipedia/commons/3/33/IBOZABcationDownC2.png" caption="year=2004}}"] ::
References
References
- Knowles, William S.. (2002). "Asymmetric Hydrogenations (Nobel Lecture) Copyright© The Nobel Foundation 2002. We thank the Nobel Foundation, Stockholm, for permission to print this lecture.". Angewandte Chemie International Edition.
- Vineyard, B. D.. (1977). "Asymmetric hydrogenation. Rhodium chiral bisphosphine catalyst". Journal of the American Chemical Society.
- H.-J.Drexler. (2004). "Cationic Rh-bisphosphine-diolefin complexes as precatalysts for enantioselective catalysis––what information do single crystal structures contain regarding product chirality?". Tetrahedron: Asymmetry.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::