Dantron

Chemical compound
title: "Dantron" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["iarc-group-2b-carcinogens", "laxatives", "dihydroxyanthraquinones", "3-hydroxypropenals-within-hydroxyquinones"] description: "Chemical compound" topic_path: "general/iarc-group-2b-carcinogens" source: "https://en.wikipedia.org/wiki/Dantron" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 322159605 | IUPAC_name = 1,8-dihydroxyanthracene-9,10-dione | image = Dantron.svg | image_class = skin-invert-image | image2 = 1,8-Dihydroxyanthraquinone-3D-balls.png | image_class2 = bg-transparent | tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Oral, rectal (enema) | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref = | CAS_number = 117-10-2 | ATC_prefix = A06 | ATC_suffix = AB03 | ATC_supplemental = | PubChem = 2950 | DrugBank_Ref = | DrugBank = DB04816 | ChemSpiderID_Ref = | ChemSpiderID = 2845 | NIAID_ChemDB = 001375 | UNII_Ref = | UNII = Z4XE6IBF3V | KEGG_Ref = | KEGG = D07107 | ChEBI_Ref = | ChEBI = 3682 | ChEMBL_Ref = | ChEMBL = 53418 | C=14 | H=8 | O=4 | density = 1.575 g/cm3 | smiles = O=C2c1cccc(O)c1C(=O)c3c2cccc3O | StdInChI_Ref = | StdInChI = 1S/C14H8O4/c15-9-5-1-3-7-11(9)14(18)12-8(13(7)17)4-2-6-10(12)16/h1-6,15-16H | StdInChIKey_Ref = | StdInChIKey = QBPFLULOKWLNNW-UHFFFAOYSA-N
Dantron (INN), also known as chrysazin or 1,8-dihydroxyanthraquinone, is an orange-colored organic substance. Many structurally-related compounds are known. In terms of its molecular structure, it is related anthraquinone by the replacement of two hydrogen atoms by hydroxyl groups (–OH). It is used in some countries as a stimulant laxative.
It should not be confused with ondansetron, an unrelated drug that was marketed in South Africa under the trade name "Dantron".
Medical uses
In the USA, dantron is not used because it is considered to be a carcinogen.
In the UK it is considered a possible carcinogen and so its use is restricted to patients who already have a diagnosis of terminal cancer. It is mainly used in palliative care to counteract the constipating effects of opioids. Its British Approved Name was danthron, but it has now been changed to "dantron", the recommended International Nonproprietary Name.
Dantron can be administered orally, or can be administered rectally as an enema either in combination with other laxatives or alone.
Side effects
Dantron has the notable side-effect of causing red-colored urine.
References
References
- (2008). "Hirshfeld Surfaces Identify Inadequacies in Computations of Intermolecular Interactions in Crystals: Pentamorphic 1,8-Dihydroxyanthraquinone". Crystal Growth & Design.
- "Danthron substance profile". [[National Toxicology Program]].
- [http://www.bnf.org/ British National Formulary website] (requires free registration)
- (13 December 2018). "A06AG Enemas". World Health Organization.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::