DALT

Chemical compound
title: "DALT" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["adrenergic-receptor-modulators", "n,n-dialkyltryptamines", "designer-drugs", "diallylamino-compounds", "dopamine-receptor-modulators", "entheogens", "psychedelic-tryptamines", "serotonin-receptor-modulators", "sigma-receptor-modulators", "tihkal"] description: "Chemical compound" topic_path: "general/adrenergic-receptor-modulators" source: "https://en.wikipedia.org/wiki/DALT" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| Watchedfields = changed | verifiedrevid = 451559106 | image = DALT-structure.png | image_class = skin-invert-image | width = 225px | image2 = DALT 3D.png | image_class2 = bg-transparent | width2 = 200px
| tradename = | pregnancy_category = | routes_of_administration = Oral, intramuscular injection | class = Serotonin receptor modulator; Serotonergic psychedelic; Hallucinogen | ATC_prefix = None | ATC_suffix =
| legal_DE = NpSG | legal_UK = Class A | legal_US = Analogue | legal_US_comment = (possibly) | legal_UN = Unscheduled but not approved for human consumption. | legal_status = in theory could be covered under similar analogue bills in other countries but this is not confirmed.
| bioavailability = | protein_bound = | metabolism = | onset = | elimination_half-life = | duration_of_action = | excretion =
| CAS_number = 60676-77-9 | UNII_Ref = | UNII = 85113MO9BC | PubChem = 24839550 | ChemSpiderID_Ref = | ChemSpiderID = 21250454 | synonyms = N,N-Diallyltryptamine; DALT; DAT
| IUPAC_name = N-Allyl-N-[2-(1H-indol-3-yl)ethyl]prop-2-en-1-amine | C=16 | H=20 | N=2 | SMILES = C=CCN(CC=C)CCc2c[nH]c1ccccc12 | StdInChI_Ref = | StdInChI = 1S/C16H20N2/c1-3-10-18(11-4-2)12-9-14-13-17-16-8-6-5-7-15(14)16/h3-8,13,17H,1-2,9-12H2 | StdInChIKey_Ref = | StdInChIKey = LQEATNFJCMVKAC-UHFFFAOYSA-N
Diallyltryptamine (DALT), also known as N,N-diallyltryptamine, is a tryptamine derivative which has been identified as a designer drug.
Use and effects
According to Alexander Shulgin in his book TiHKAL (Tryptamines I Have Known and Loved), the dose of DALT is greater than 40mg orally and its duration is unknown. Its effects were not described. Per Stephen Szara and colleagues in much earlier publications however, DALT and other extended N,N-dialkyltryptamines produce similar effects to dimethyltryptamine (DMT) but are longer-lasting, with durations of up to 3hours.
Interactions
Pharmacology
Pharmacodynamics
::data[format=table title="{{Nowrap|DALT activities}}"]
| Target | Affinity (Ki, nM) |
|---|---|
| 5-HT1A | 100 |
| 5-HT1B | 10,000 |
| 5-HT1D | 689 |
| 5-HT1E | 378 |
| 5-HT1F | ND |
| 5-HT2A | 701 |
| 5-HT2B | 61 |
| 5-HT2C | 385 |
| 5-HT3 | 10,000 |
| 5-HT4 | ND |
| 5-HT5A | 10,000 |
| 5-HT6 | 1,718 |
| 5-HT7 | 10,000 |
| α1A | 1,663 |
| α1B | 1,369 |
| α1D | 10,000 |
| α2A | 124 |
| α2B | 305 |
| α2C | 901 |
| β1–β3 | 10,000 |
| D1, D2 | 10,000 |
| D3 | 672 |
| D4, D5 | 10,000 |
| H1 | 127 |
| H2–H4 | 10,000 |
| M1–M5 | 10,000 |
| I1 | ND |
| σ1 | 101 (rat) |
| σ2 | 356 (rat) |
| ND | |
| , | 10,000 |
| 2,477 | |
| 150 (Ki) | |
| 1,121 (Ki) | |
| 1,406 (Ki) | |
| Notes: The smaller the value, the more avidly the drug binds to the site. All proteins are human unless otherwise specified. Refs: | |
| :: |
The receptor interactions of DALT have been studied. The drug produces the head-twitch response, a behavioral proxy of psychedelic effects, in rodents.
Chemistry
DALT has been used as an intermediate in the preparation of radiolabeled diethyltryptamine (DET).
Synthesis
The chemical synthesis of DALT has been described.
Analogues
Analogues of DALT include 4-HO-DALT, 4-AcO-DALT, 5-MeO-DALT, methylallyltryptamine (MALT), propylallyltryptamine (PALT), and isopropylallyltryptamine (iPALT), among others.
History
DALT was first described in the scientific literature by Stephen Szara and colleagues by 1962.
Society and culture
Legal status
Canada
DALT is not an explicitly nor implicitly controlled substance in Canada as of 2025.
United States
DALT is not an explicitly controlled substance in the United States. However, it could be considered a controlled substance under the Federal Analogue Act if intended for human consumption.
References
References
- (October 2015). "Metabolism of the new psychoactive substances N,N-diallyltryptamine (DALT) and 5-methoxy-DALT and their detectability in urine by GC-MS, LC-MSn, and LC-HR-MS-MS". Analytical and Bioanalytical Chemistry.
- (February 2017). "n, and LC-HR-MS/MS". Analytical and Bioanalytical Chemistry.
- {{CiteTiHKAL
- (28 March 2025). "Kᵢ Database".
- (2016). "BindingDB BDBM50140058 CHEMBL3752576". Bioorganic & Medicinal Chemistry Letters.
- (February 2016). "Receptor binding profiles and quantitative structure-affinity relationships of some 5-substituted-N,N-diallyltryptamines". Bioorganic & Medicinal Chemistry Letters.
- (November 2018). "Receptor binding profiles and behavioral pharmacology of ring-substituted N,N-diallyltryptamine analogs". Neuropharmacology.
- (2018). "Behavioral Neurobiology of Psychedelic Drugs".
- (2008). "Microwave-accelerated synthesis of psychoactive deuterated N,N-dialkylated-[α,α,β,β-d4]-tryptamines". Journal of Labelled Compounds and Radiopharmaceuticals.
- (1975). "Hallucinogenic Agents". Wright-Scientechnica.
- (1962). "The 6-Hydroxylation of Tryptamine Derivatives: A Way of Producing Psychoactive Metabolites". Annals of the New York Academy of Sciences.
- (5 December 2025). "Controlled Drugs and Substances Act".
- (January 2026). "Orange Book: List of Controlled Substances and Regulated Chemicals (January 2026)". U.S. [[Department of Justice]]: [[Drug Enforcement Administration]] (DEA): Diversion Control Division.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::