Cyclazocine

Chemical compound


title: "Cyclazocine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["synthetic-opioids", "hallucinogenic-kappa-opioid-receptor-agonists", "hydroxyarenes", "benzomorphans"] description: "Chemical compound" topic_path: "general/synthetic-opioids" source: "https://en.wikipedia.org/wiki/Cyclazocine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 460109436 | IUPAC_name = 3-(Cyclopropylmethyl)-6,11-dimethyl-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol or 2-Cyclopropylmethyl-2'-hydroxy-5,9-dimethyl-6,7-benzomorphan | image = Cyclazocine structure.svg | image_class = skin-invert-image | width = 200px | image2 = Cyclazocine 3D.png | image_class2 = bg-transparent | width2 = 200px

| tradename = | pregnancy_category = | legal_status = | routes_of_administration = By mouth | bioavailability = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref = | CAS_number = 3572-80-3 | ATC_prefix = none | ATC_suffix = | PubChem = 19143 | IUPHAR_ligand = 1604 | ChemSpiderID_Ref = | ChemSpiderID = 18063 | UNII_Ref = | UNII = J5W1B1159C | KEGG_Ref = | KEGG = D03618 | ChEMBL_Ref = | ChEMBL = 56585

| C = 18 | H = 25 | N = 1 | O = 1 | smiles = Oc1ccc4c(c1)C2(C(C(N(CC2)CC3CC3)C4)C)C | StdInChI_Ref = | StdInChI = 1S/C18H25NO/c1-12-17-9-14-5-6-15(20)10-16(14)18(12,2)7-8-19(17)11-13-3-4-13/h5-6,10,12-13,17,20H,3-4,7-9,11H2,1-2H3 | StdInChIKey_Ref = | StdInChIKey = YQYVFVRQLZMJKJ-UHFFFAOYSA-N

Cyclazocine is a mixed opioid agonist/antagonist related to dezocine, pentazocine and phenazocine. It is in the benzomorphan and benzazocine family of drugs. It is a κ-opioid receptor agonist and μ-opioid receptor partial agonist, and also has high affinity for the δ-opioid receptor.

Research

Research into the use of cyclazocine for the treatment of bipolar patients with depression was undertaken by Fink and colleagues (1970). It showed that 8 out of 10 patients experienced moderate improvement.

Research during the 1960s and 1970s into the possible use of cyclazocine for management of pain, and later for assisting treatment of opioid addiction was severely hampered by the drug's psychotomimetic, dysphoric, and hallucinatory effects. The dysphoric/anxiety-inducing effects of the drug correlate with increasing dosage and would likely reduce the risk of abuse in the same manner as other opioids which preferentially act on the KOR versus the DOR and MOR, although the side-effect threshold is often lower than the lowest effective dose.

References

References

  1. (November 1996). "Cyclazocine revisited". Neurochemical Research.
  2. (July 2002). "8-Carboxamidocyclazocine: a long-acting, novel benzomorphan". The Journal of Pharmacology and Experimental Therapeutics.
  3. (October 1967). "Cyclazocine and methadone in narcotic addiction". JAMA.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

synthetic-opioidshallucinogenic-kappa-opioid-receptor-agonistshydroxyarenesbenzomorphans