Cubebol

Quality 0.50 · 1 view · Updated 2 months ago

title: "Cubebol" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["cooling-flavors", "tertiary-alcohols", "sesquiterpenes", "cyclopropanes", "cyclopentanes", "isopropyl-compounds"] topic_path: "general/cooling-flavors" source: "https://en.wikipedia.org/wiki/Cubebol" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Watchedfields = changed | verifiedrevid = 425526696 | ImageFile = Cubebol.png | ImageSize = | PIN = (3S,3aR,3bR,4S,7R,7aR)-3,7-Dimethyl-4-(propan-2-yl)octahydro-1H-cyclopenta[1,3]cyclopropa[1,2-a]benzen-3-ol | OtherNames = |Section1={{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 9451107 | InChI = 1/C15H26O/c1-9(2)11-6-5-10(3)15-8-7-14(4,16)13(15)12(11)15/h9-13,16H,5-8H2,1-4H3/t10-,11+,12-,13+,14+,15-/m1/s1 | InChIKey = KONGRWVLXLWGDV-BYGOPZEFBC | SMILES1 = O[C@]3(CC[C@@]12C@@HC)C | StdInChI_Ref = | StdInChI = 1S/C15H26O/c1-9(2)11-6-5-10(3)15-8-7-14(4,16)13(15)12(11)15/h9-13,16H,5-8H2,1-4H3/t10-,11+,12-,13+,14+,15-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = KONGRWVLXLWGDV-BYGOPZEFSA-N | CASNo_Ref = | CASNo = 23445-02-5 | UNII_Ref = | UNII = 9C9ZTS2B3U | PubChem = 11276107 | SMILES = [H][C@]12C@HCCC@@H[C@]31C@@2C@@(O)CC3 |Section2={{Chembox Properties | Formula = C15H26O | MolarMass = 222.37 g/mol | Appearance = | Density = | MeltingPtC = 61 to 62 | MeltingPt_notes = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =

Cubebol is a natural sesquiterpene alcohol first identified in cubeb oil. It is also found in basil. It was patented as a cooling agent in 2001 by Firmenich, an international flavor company. The taste of cubebol is cooling and refreshing. The patent describes application of cubebol as a refreshing agent in various products, ranging from chewing gum to sorbets, drinks, toothpaste, and gelatin-based confectioneries.

References

References

  1. Leffingwell, John C., Ph.D.. (2001). "Cool without Menthol & Cooler than Menthol and Cooling Compounds as Insect Repellents". Leffingwell & Associates.
  2. {{US patent. 6214788

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

cooling-flavorstertiary-alcoholssesquiterpenescyclopropanescyclopentanesisopropyl-compounds