Cresol Red

Quality 0.50 · 1 view · Updated 2 months ago

title: "Cresol Red" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["triarylmethane-dyes", "phenol-dyes", "benzoxathioles"] topic_path: "general/triarylmethane-dyes" source: "https://en.wikipedia.org/wiki/Cresol_Red" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 416907625 | Name = Cresol Red | ImageFile = Cresol Red.svg | ImageFile2 = Cresol-red-3D-sticks.png | ImageSize2 = 200px | PIN = 3,3-Bis(4-hydroxy-3-methylphenyl)-2,1λ6-benzoxathiole-1,1(3H)-dione | Section1 = {{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 65818 | ChEBI_Ref = | ChEBI = 86218 | PubChem = 73013 | InChI = 1/C21H18O5S/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21/h3-12,22-23H,1-2H3 | InChIKey = OBRMNDMBJQTZHV-UHFFFAOYAD | StdInChI_Ref = | StdInChI = 1S/C21H18O5S/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26-21/h3-12,22-23H,1-2H3 | StdInChIKey_Ref = | StdInChIKey = OBRMNDMBJQTZHV-UHFFFAOYSA-N | CASNo_Ref = | CASNo = 1733-12-6 | UNII_Ref = | UNII = 839K2R4B8K | SMILES = Cc1cc(ccc1O)/C(=C/2C=CC(=O)C(=C2)C)c3ccccc3OS(O)=O | Section2 = {{Chembox Properties | Formula = C21H17NaO5S | MolarMass = 382.43 g/mol | Density = | MeltingPt = | BoilingPt =

Cresol red (full name: o-cresolsulfonephthalein) is a triarylmethane dye frequently used for monitoring the pH in aquaria.

Molecular biology

Cresol red can be used in many common molecular biology reactions in place of other loading dyes. Cresol Red does not inhibit Taq polymerase to the same degree as other common loading dyes.

Color marker

Cresol red can also be used as an electrophoretic color marker to monitor the process of agarose gel electrophoresis and polyacrylamide gel electrophoresis. In a 1% agarose gel, it runs approximately at the size of a 125 base pair (bp) DNA molecule (it depends on the concentration of buffer and other component). Bromophenol blue and xylene cyanol can also be used for this purpose.

References

References

  1. PubChem. "Cresol red".

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

triarylmethane-dyesphenol-dyesbenzoxathioles