Cloxazolam

Benzodiazepine medication


title: "Cloxazolam" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["anxiolytics", "chloroarenes", "lactams", "oxazolobenzodiazepines", "prodrugs", "2-chlorophenyl-compounds"] description: "Benzodiazepine medication" topic_path: "general/anxiolytics" source: "https://en.wikipedia.org/wiki/Cloxazolam" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Benzodiazepine medication ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 455325466 | IUPAC_name = 10-chloro-11b-(2-chlorophenyl)-2,3,5,7-tetrahydro-[1,3]oxazolo[3,2-d][1,4]benzodiazepin-6-one | image = File:Cloxazolam.svg | image_class = skin-invert-image | width = 150 | image2 = Cloxazolam-3d-model.png | image_class2 = bg-transparent

| tradename = Akton, Cloxam, Clozal, Elum, Olcadil, and Sepazon | Drugs.com = | pregnancy_category = | legal_BR = B1 | legal_BR_comment = | legal_CA = Schedule IV | legal_DE = Anlage III | legal_UK = Class C | legal_US = Schedule IV | routes_of_administration = Oral

| bioavailability = | metabolism = Hepatic | elimination_half-life = 65 hours | excretion = Renal

| CAS_number_Ref = | CAS_number = 24166-13-0 | ATC_prefix = N05 | ATC_suffix = BA22 | PubChem = 2816 | ChEMBL_Ref = | ChEMBL = 2107254 | DrugBank_Ref = | DrugBank = DB01553 | ChemSpiderID_Ref = | ChemSpiderID = 2714 | UNII_Ref = | UNII = GYL649Z0HY | KEGG_Ref = | KEGG = D01268

| C=17 | H=14 | Cl=2 | N=2 | O=2 | smiles = Clc1ccccc1C42OCCN2CC(=O)Nc3c4cc(Cl)cc3 | StdInChI_Ref = | StdInChI = 1S/C17H14Cl2N2O2/c18-11-5-6-15-13(9-11)17(12-3-1-2-4-14(12)19)21(7-8-23-17)10-16(22)20-15/h1-6,9H,7-8,10H2,(H,20,22) | StdInChIKey_Ref = | StdInChIKey = ZIXNZOBDFKSQTC-UHFFFAOYSA-N

Cloxazolam is a benzodiazepine derivative that has anxiolytic, sedative, and anticonvulsant properties. It is not widely used; In 2019, it has been retired from the Belgian market.

References

References

  1. Anvisa. (2023-03-31). "RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial". [[Diário Oficial da União]].
  2. (2010). "Encyclopedia of Psychopharmacology". Springer-Verlag.
  3. (January 2012). "Muscle relaxants for pain management in rheumatoid arthritis". The Cochrane Database of Systematic Reviews.
  4. "Cloxazolam International Brands". Drugs.com.
  5. "Bon à savoir". cbip.be.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

anxiolyticschloroareneslactamsoxazolobenzodiazepinesprodrugs2-chlorophenyl-compounds