Clopamide

Chemical compound


title: "Clopamide" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["piperidines", "sulfonamides", "hydrazides", "drugs-developed-by-novartis", "diuretics", "carbonic-anhydrase-inhibitors"] description: "Chemical compound" topic_path: "general/piperidines" source: "https://en.wikipedia.org/wiki/Clopamide" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | verifiedrevid = 447611902 | IUPAC_name = 4-chloro-N-(2,6-dimethyl-1-piperidyl)-3-sulfamoyl- benzamide | image = Clopamide.svg | image_class = skin-invert-image | image2 = Clopamide ball-and-stick.png | image_class2 = bg-transparent

| tradename = Brinaldix | Drugs.com = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = 636-54-4 | ATC_prefix = C03 | ATC_suffix = BA03 | PubChem = 2804 | DrugBank_Ref = | DrugBank = | ChEMBL_Ref = | ChEMBL = 1361347 | ChemSpiderID_Ref = | ChemSpiderID = 2702 | UNII_Ref = | UNII = 17S83WON0I | KEGG_Ref = | KEGG = D02460

| C=14 | H=20 | Cl=1 | N=3 | O=3 | S=1 | smiles = O=C(NN1C(CCCC1C)C)c2ccc(Cl)c(c2)S(=O)(=O)N | StdInChI_Ref = | StdInChI = 1S/C14H20ClN3O3S/c1-9-4-3-5-10(2)18(9)17-14(19)11-6-7-12(15)13(8-11)22(16,20)21/h6-10H,3-5H2,1-2H3,(H,17,19)(H2,16,20,21) | StdInChIKey_Ref = | StdInChIKey = LBXHRAWDUMTPSE-UHFFFAOYSA-N

Clopamide (trade name Brinaldix) is a piperidine diuretic.

Mechanism of action

Clopamide is categorised as a thiazide-like diuretic and works in similar way as the thiazide diuretics do. It acts in the kidneys, at the distal convoluted tubule (DCT) of the nephron where it inhibits the sodium-chloride symporter. Clopamide selectively binds at the chloride binding site of the sodium-chloride symporter in the PCT cells on the luminal (interior) side and thus interferes with the reabsorption of sodium chloride, causing an equiosmolar excretion of water along with sodium chloride.

References

References

  1. (September 1987). "Clopamide: plasma concentrations and diuretic effect in humans". Clinical Pharmacology and Therapeutics.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

piperidinessulfonamideshydrazidesdrugs-developed-by-novartisdiureticscarbonic-anhydrase-inhibitors