Clinofibrate

Chemical compound
title: "Clinofibrate" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["2-methyl-2-phenoxypropanoic-acid-derivatives", "dicarboxylic-acids", "2,2-bis(4-hydroxyphenyl)propanes"] description: "Chemical compound" topic_path: "general/2-methyl-2-phenoxypropanoic-acid-derivatives" source: "https://en.wikipedia.org/wiki/Clinofibrate" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| Verifiedfields = changed | verifiedrevid = 444136817 | IUPAC_name = 2-(4-{1-[4-(1-carboxy-1-methylpropoxy)phenyl]cyclohexyl}phenoxy)-2-methylbutanoic acid | image = Clinofibrate.svg | image_class = skin-invert-image
| tradename = | Drugs.com = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = Oral
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = 30299-08-2 | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | ChEMBL_Ref = | ChEMBL = 1897738 | PubChem = 2787 | ChemSpiderID_Ref = | ChemSpiderID = 21613360 | StdInChI_Ref = | StdInChI = 1S/C28H36O6/c1-5-26(3,24(29)30)33-22-15-13-20(14-16-22)28(17-8-7-9-18-28)21-11-10-12-23(19-21)34-27(4,6-2)25(31)32/h10-16,19H,5-9,17-18H2,1-4H3,(H,29,30)(H,31,32) | StdInChIKey_Ref = | StdInChIKey = OGGAHXJZRRGBTK-UHFFFAOYSA-N | DrugBank_Ref = | DrugBank = DB09006 | UNII_Ref = | UNII = 0374EZJ8CU | KEGG_Ref = | KEGG = D01300
| chemical_formula = | C=28 | H=36 | O=6 | smiles = CCC(C)(C(=O)O)OC1=CC=C(C=C1)C2(CCCCC2)C3=CC=C(C=C3)OC(C)(CC)C(=O)O
Clinofibrate (INN; trade name Lipoclin) is pharmaceutical drug of the fibrate class that is used for managing hyperlipidemia and associated conditions.{{cite web | url = https://synapse.patsnap.com/article/what-is-clinofibrate-used-for | title = What is Clinofibrate used for? | date = 14 June 2024 | work = Synapse }} It is sold and marketed in Japan.
Chemically, it is a derivative of bisphenol Z.
Synthesis
The condensation between cyclohexanone (1) and phenol (2) gives bisphenol Z (3). This is treated with chloroform and methyl ethyl ketone (MEK) in the presence of base. The resulting Bargellini reaction gives clinofibrate (4). :[[File:Clinofibrate synthesis.svg|thumb|left|500px|Synthesis of clinofibrate]]
References
References
- "Clinofibrate". [[DrugBank]].
- (April 1982). "Effect of clinofibrate, a new hypolipidemic agent, on biliary and serum lipids in patients with hyperlipidemia". Atherosclerosis.
- (2011). "An Improved, Highly Efficient Method for the Synthesis of Bisphenols". e-Journal of Chemistry.
- "Phenoxy carboxylic acid derivative".
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::