Chiraphos


title: "Chiraphos" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["diphosphines", "phenyl-compounds"] topic_path: "general/diphosphines" source: "https://en.wikipedia.org/wiki/Chiraphos" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 428730398 | ImageFile = Chiraphos.svg | ImageFileL2 = Chiraphos-3D-balls-by-AHRLS-2012.png | ImageSizeL2 = 140 | ImageFileR2 = Chiraphos-3D-sticks-by-AHRLS-2012.png | ImageSizeR2 = 140 | PIN = rel-[(2R,3R)-Butane-2,3-diyl]bis(diphenylphosphane) | OtherNames = |Section1={{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 8288775 | PubChem = 10113249 | InChI = 1/C28H28P2/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-24H,1-2H3/t23-,24-/m0/s1 | InChIKey = FWXAUDSWDBGCMN-ZEQRLZLVBA | SMILES = P(c1ccccc1)(c2ccccc2)C@HC | StdInChI_Ref = | StdInChI = 1S/C28H28P2/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-24H,1-2H3/t23-,24-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = FWXAUDSWDBGCMN-ZEQRLZLVSA-N | CASNo_Ref = | CASNo = 74839-84-2 | CASNo_Comment = (R,R) | CASNo1_Ref = | CASNo1 = 64896-28-2 | CASNo1_Comment = (S,S) | UNII_Ref = | UNII = 1T086B9Q1J | UNII_Comment = (R,R) | UNII1_Ref = | UNII1 = 6QR78GZL9B | UNII1_Comment = (S,S) |Section2={{Chembox Properties | Formula = C28H28P2 | Appearance = White powder | MolarMass = 426.47 g/mol | MeltingPtC = 104 to 109 | MeltingPt_notes = |Section3={{Chembox Hazards | GHSPictograms = | GHSSignalWord = Warning | HPhrases = | PPhrases =

Chiraphos is a chiral diphosphine employed as a ligand in organometallic chemistry. This bidentate ligand chelates metals via the two phosphine groups. Its name is derived from its description — being both chiral and a phosphine. As a C2-symmetric ligand, chiraphos is available in two enantiomeric forms, S,S and R,R, each with C2 symmetry.

Preparation

Chiraphos is prepared from S,S or R,R-2,3-butanediol, which are derived from commercially available S,S or R,R-tartaric acid; the technique of using cheaply available enantiopure starting materials is known as chiral pool synthesis. The diol is tosylated and then the ditosylate is treated with lithium diphenylphosphide. The ligand was an important demonstration of how the conformation of the chelate ring can affect asymmetric induction by a metal catalyst. Prior to this work, in most chiral phosphines, e.g., DIPAMP, phosphorus was the stereogenic center.

::[[Image:ChiraphosSyn.png|330px]]

References

References

  1. (1977). "Asymmetric synthesis. Production of optically active amino acids by catalytic hydrogenation". Journal of the American Chemical Society.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

diphosphinesphenyl-compounds