Calmagite


title: "Calmagite" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["complexometric-indicators", "azo-compounds", "2-naphthols", "naphthalenesulfonic-acids"] topic_path: "general/complexometric-indicators" source: "https://en.wikipedia.org/wiki/Calmagite" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Reference = | ImageFile = Calmagite.png | ImageName = Skeletal formula | ImageFile1 = Calmagite-3D-balls-A.png | ImageSize1 = 220px | ImageName1 = Ball-and-stick model | IUPACName = 3-Hydroxy-4-[(2-hydroxy-5-methylphenyl)azo]-1-naphthalenesulfonic acid |Section1={{Chembox Identifiers | ChemSpiderID = 21159783 | InChI = 1/C17H14N2O5S/c1-10-6-7-14(20)13(8-10)18-19-17-12-5-3-2-4-11(12)16(9-15(17)21)25(22,23)24/h2-9,20-21H,1H3,(H,22,23,24) | InChIKey = VBRNLOQCBCPPHL-UHFFFAOYAD | CASNo = 3147-14-6 | CASNo_Ref = | UNII_Ref = | UNII = 0A3KVV9HZC | PubChem = 5483111 | SMILES = Oc3ccc(C)cc3N=Nc2c1ccccc1c(cc2O)S(O)(=O)=O |Section2={{Chembox Properties | C=17 | H=14 | N=2 | O=5 | S=1 | Appearance = Red to black crystals | Odor = Phenolic odor | Density = | MeltingPtC = 330 | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = May emit ammonia, oxides of sulfur, oxides of nitrogen, and oxides of carbon. | FlashPt = | AutoignitionPt =

Calmagite is a complexometric indicator used in analytical chemistry to identify the presence of metal ions in solution. As with other metal ion indicators calmagite will change color when it is bound to an ion. Calmagite will be wine red when it is bound to a metal ion and may be blue, red, or orange when it is not bound to a metal ion. Calmagite is often used in conjunction with EDTA, a stronger metal binding agent. This chemical is also used in the quantitation of magnesium in the clinical laboratory.

References

References

  1. [http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=C204|ALDRICH&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC Calmagite] at [[Sigma-Aldrich]]
  2. Harris, Daniel C. ''Quantitative Chemical Analysis'', W.H. Freeman and Company ,2007. {{ISBN. 0-7167-7041-5

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

complexometric-indicatorsazo-compounds2-naphtholsnaphthalenesulfonic-acids