Cafaminol

Quality 0.50 · 2 views · Updated 2 months ago

Chemical compound

title: "Cafaminol" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["decongestants", "vasoconstrictors", "xanthines"] description: "Chemical compound" topic_path: "general/decongestants" source: "https://en.wikipedia.org/wiki/Cafaminol" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| IUPAC_name = 8-[(2-hydroxyethyl)(methyl)amino]-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione | image = Cafaminol.svg | image_class = skin-invert-image | width = 250px | alt = Skeletal formula of cafaminol | image2 = Cafaminol 3D ball.png | image_class2 = bg-transparent | width2 = 225px | alt2 = Ball-and-stick model of the cafaminol molecule

| tradename = Rhinetten, Rhinoptil | pregnancy_category = | legal_status = Rx-only | routes_of_administration = | bioavailability = | metabolism = | elimination_half-life = | excretion = | CAS_number = 30924-31-3 | ATC_prefix = None | ATC_suffix = | PubChem = 35685 | ChemSpiderID = 32824 | ChEMBL = 2104570 | UNII_Ref = | UNII = 0L1S25NC1L | synonyms = Methylcoffanolamine; 8-[(2-Hydroxyethyl)(methyl)amino]caffeine

| C = 11 | H = 17 | N = 5 | O = 3 | SMILES = O=C2N(c1nc(n(c1C(=O)N2C)C)N(CCO)C)C | StdInChI = 1S/C11H17N5O3/c1-13(5-6-17)10-12-8-7(14(10)2)9(18)16(4)11(19)15(8)3/h17H,5-6H2,1-4H3 | StdInChIKey = ZGNRRVAPHPANFI-UHFFFAOYSA-N

Cafaminol (brand names Rhinetten, Rhinoptil), also known as methylcoffanolamine, is a vasoconstrictor and anticatarrhal of the methylxanthine family related to caffeine which is used as a nasal decongestant in Germany. It was introduced in 1974 and was still in use as of 2000.

References

References

  1. J. Elks. (14 November 2014). "The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies". Springer.
  2. (2000). "Index Nominum 2000: International Drug Directory". Taylor & Francis.
  3. William Andrew Publishing. (22 October 2013). "Pharmaceutical Manufacturing Encyclopedia". Elsevier.
  4. (1969). "[A new treatment for colds using a new caffeine derivative, methylcoffanolamine]". Praxis.
  5. (1979). "[Human pharmacologic studies on the biologic availability and resorption of cafaminol (AWD) (proceedings)]". Pharmazie.
  6. (1985). "[Use of the preparation Cafaminol in the treatment of acute rhinitis]". Wiad. Lek..

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

decongestantsvasoconstrictorsxanthines