Caesium sulfate

Quality 0.50 · 1 view · Updated 2 months ago

title: "Caesium sulfate" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["caesium-compounds", "sulfates"] topic_path: "general/caesium-compounds" source: "https://en.wikipedia.org/wiki/Caesium_sulfate" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 405204542 | Reference = | ImageFile1 = Caesium-sulfate-2D-structure.svg | ImageFile2 = Structure of K2SO4, K2CrO4 and some related compounds.tif | Name = Caesium sulfate | OtherNames = Cesium sulfate |Section1={{Chembox Identifiers | InChI = 1/2Cs.H2O4S/c;;1-5(2,3)4/h;;(H2,1,2,3,4)/q2*+1;/p-2 | SMILES = [Cs+].[Cs+].[O-]S([O-])(=O)=O | InChIKey = FLJPGEWQYJVDPF-NUQVWONBAO | StdInChI_Ref = | StdInChI = 1S/2Cs.H2O4S/c;;1-5(2,3)4/h;;(H2,1,2,3,4)/q2*+1;/p-2 | StdInChIKey_Ref = | StdInChIKey = FLJPGEWQYJVDPF-UHFFFAOYSA-L | CASNo = 10294-54-9 | CASNo_Ref = | PubChem = 25137 | UNII_Ref = | UNII = 8D6R91CS62

| EC_number = 233-662-6 | ChemSpiderID_Ref = | ChemSpiderID = 23482 |Section2={{Chembox Properties | Formula = Cs2SO4 | MolarMass = 361.87 g/mol | Density = 4.243 g/cm3, solid | MeltingPtC = 1010 | Solubility = 167 g/100 ml (0 °C) 179 g/100 ml (20 °C) | SolubleOther = insoluble in ethanol, acetone | MagSus = −116.0·10−6 cm3/mol |Section7={{Chembox Hazards | FlashPt = Non-flammable | LD50 = 2830 mg/kg (oral, rat) | GHSSignalWord = Warning | GHSPictograms = | HPhrases = | PPhrases = |Section8={{Chembox Related | OtherAnions = Caesium hydrogen sulfate | OtherCations = Lithium sulfate Sodium sulfate Potassium sulfate Rubidium sulfate

Caesium sulfate, cesium sulfate, caesium sulphate or cesium sulphate is the inorganic compound and salt with the formula Cs2SO4. It is a white water-soluble solid that is used to prepare dense aqueous solutions for use in isopycnic centrifugation. It is isostructural with potassium sulfate.

File:TopView10cnK.tif|Coordination sphere of one of two types of Cs+ site in Cs2SO4. File:SO4sphere.tif|Environment of sulfate anion in β-Cs2SO4.

References

References

  1. {{RubberBible62nd
  2. PubChem. "Cesium sulfate".
  3. Bonnet, F.. (1980-05-29). "Proteoglycan complex and proteoglycan subunit polydispersity. Study by isopycnic centrifugation in cesium sulfate density gradients". Biochimica et Biophysica Acta (BBA) - Protein Structure.
  4. Nord, A.G. "The crystal structure of cesium sulfate, beta-Cs2SO4" Acta Chemica Scandinavica, Series A: 1976, 30, p198.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

caesium-compoundssulfates