BU-LAD

Quality 0.50 · 0 views · Updated 2 months ago

Chemical compound

title: "BU-LAD" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["butyl-compounds", "carboxamides", "david-e.-nichols", "diethylamino-compounds", "psychedelic-lysergamides"] description: "Chemical compound" topic_path: "general/butyl-compounds" source: "https://en.wikipedia.org/wiki/BU-LAD" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | verifiedrevid = 458978391 | image = BU-LAD-2D-skeletal.svg | image_class = skin-invert-image | width = 225px | image2 = BU-LAD ball-and-stick structure.png | image_class2 = bg-transparent | width2 = 225px

| tradename = | routes_of_administration = Oral | class = Serotonergic psychedelic; Hallucinogen

| legal_AU = | legal_CA = | legal_UK = | legal_US = analogue | legal_US_comment = (but only if it is intended for human consumption)

| bioavailability = | protein_bound = | metabolism = | onset = | elimination_half-life = | duration_of_action = | excretion =

| CAS_number_Ref = | CAS_number = 96930-87-9 | UNII_Ref = | UNII = 4Z2TQQ6ZTC | ChEMBL_Ref = | ChEMBL = 22520 | PubChem = 44457782 | ChemSpiderID_Ref = | ChemSpiderID = 21106266 | synonyms = BU-LAD; BULAD; 6-Butyl-6-nor-LSD; 6-Butyl-6-nor-Lysergic acid diethylamide

| IUPAC_name = (6aR,9R)-7-butyl-N,N-diethyl-4,6,6a,7,8,9- hexahydroindolo[4,3-fg]quinoline-9-carboxamide | C=23 | H=31 | N=3 | O=1 | SMILES = CCN(CC)C(=O)[C@@H]2C=C1c3cccc4[nH]cc(C[C@H]1N(C2)CCCC)c34 | StdInChI_Ref = | StdInChI = 1S/C23H31N3O/c1-4-7-11-26-15-17(23(27)25(5-2)6-3)12-19-18-9-8-10-20-22(18)16(14-24-20)13-21(19)26/h8-10,12,14,17,21,24H,4-7,11,13,15H2,1-3H3/t17-,21-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = VTVHSIXDKKKTMT-DYESRHJHSA-N

BU-LAD, also known as 6-butyl-6-nor-LSD or 6-butyl-6-nor-lysergic acid diethylamide, is a psychedelic drug and analogue of lysergic acid diethylamide (LSD) first described by David E. Nichols and colleagues in the 1980s.

Use and effects

According to Alexander Shulgin in his book TiHKAL (Tryptamines I Have Known and Loved), BU-LAD is a psychedelic drug similar to LSD, but is significantly less potent than LSD, with a dose of 500μg orally producing only mild effects.

Interactions

Chemistry

Analogues

Analogues of BU-LAD include LSD, ETH-LAD, PRO-LAD, AL-LAD, PARGY-LAD, and MAL-LAD, among others.

References

References

  1. (1991). "Biochemistry and Physiology of Substance Abuse". CRC Press.
  2. (September 1985). "Synthesis and LSD-like discriminative stimulus properties in a series of N(6)-alkyl norlysergic acid N,N-diethylamide derivatives". Journal of Medicinal Chemistry.
  3. {{CiteTiHKAL

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

butyl-compoundscarboxamidesdavid-e.-nicholsdiethylamino-compoundspsychedelic-lysergamides