Auramine O

Quality 0.50 · 3 views · Updated 2 months ago

title: "Auramine O" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["diarylmethane-dyes", "staining-dyes", "antiseptics", "hydrochlorides"] topic_path: "general/diarylmethane-dyes" source: "https://en.wikipedia.org/wiki/Auramine_O" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Watchedfields = changed | verifiedrevid = 401809121 | Name = Auramine O | ImageFile = Auramine O Formula V.1.svg | ImageName = 340 | ImageFileL1 = Sample of Auramine O.jpg | ImageSizeL1 = 130 | ImageCaptionL1 = Solid Auramine O | ImageFileR1 = Auramine O in aqueous solution.jpg | ImageSizeR1 = 130 | ImageCaptionR1 = Auramine O in aqueous solution | IUPACName = bis[4-(dimethylamino)phenyl]methaniminium chloride | OtherNames = auramine hydrochloride, basic yellow 2, pyocatanium aureum, aizen auramine, pyoktanin yellow, canary yellow, pyoktanin, or C.I. 41000 |Section1={{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 16254 | InChI = 1/C17H21N3/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4/h5-12,18H,1-4H3 | InChIKey = JPIYZTWMUGTEHX-UHFFFAOYAY | PubChem = 17170 | EC_number = 219-567-2 | UNII = DL992L7W39 | InChI1 = 1/C17H21N3.ClH/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4;/h5-12,18H,1-4H3;1H | InChIKey1 = KSCQDDRPFHTIRL-UHFFFAOYAK | SMILES1 = Cl.[N@H]=C(c1ccc(N(C)C)cc1)c2ccc(N(C)C)cc2 | StdInChI_Ref = | StdInChI = 1S/C17H21N3.ClH/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4;/h5-12,18H,1-4H3;1H | StdInChIKey_Ref = | StdInChIKey = KSCQDDRPFHTIRL-UHFFFAOYSA-N | CASNo_Ref = | CASNo = 2465-27-2 | SMILES = [N@H]=C(c1ccc(N(C)C)cc1)c2ccc(N(C)C)cc2 |Section2={{Chembox Properties | C=17 | H=22 | N=3 | Cl=1 | Density = | MeltingPtC = 267 | MeltingPt_notes = | BoilingPt = |Section7={{Chembox Hazards | GHSPictograms = | GHSSignalWord = Danger | HPhrases = | PPhrases = | NFPA-H = 3 | NFPA-F = 1 | NFPA-R = 0

Auramine O is a diarylmethane dye used as a fluorescent stain. In its pure form, Auramine O appears as yellow needle crystals. It is insoluble in water and soluble in ethanol and DMSO.

Auramine O can be used to stain acid-fast bacteria (e.g. Mycobacterium, where it binds to the mycolic acid in its cell wall) in a way similar to Ziehl–Neelsen stain. It can also be used as a fluorescent version of the Schiff reagent.

Auramine O can be used together with Rhodamine B as the Truant auramine-rhodamine stain for Mycobacterium tuberculosis. It can be also used as an antiseptic agent.

References

References

  1. (1984). "Nontuberculous mycobacterial infections: comparison of the fluorescent auramine-O and Ziehl–Neelsen techniques in tissue diagnosis". Hum Pathol.
  2. (1980). "Fluorescent PAS-reaction study of the epithelium of normal rabbit ileum and after challenge with enterotoxigenic Escherichia coli". Gastroenterology.
  3. (1962). "Fluorescence microscopy of tubercle bacilli stained with auramine and rhodamine". Henry Ford Hosp Med Bull.
  4. (1989). "Comparison of conventional staining methods and monoclonal antibody-based methods for Cryptosporidium oocyst detection". J Clin Microbiol.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

diarylmethane-dyesstaining-dyesantisepticshydrochlorides