Armstrong acid

Quality 0.50 · 0 views · Updated 2 months ago

title: "Armstrong acid" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["reagents-for-organic-chemistry", "naphthalenesulfonic-acids"] topic_path: "science/chemistry" source: "https://en.wikipedia.org/wiki/Armstrong_acid" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| verifiedrevid = 443398401 | Name = Armstrong's acid | ImageFileL1 = Naphthalene-1,5-disulfonic acid.png | ImageSizeL1 = 125 | ImageAltL1 = Skeletal formula of Armstrong's acid | ImageFileR1 = Armstrong's-acid-3D-balls.png | ImageSizeR1 = 135 | ImageAltR1 = Ball-and-stick model of the Armstrong's acid molecule | PIN = Naphthalene-1,5-disulfonic acid | OtherNames = Armstrong's acid |Section1={{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 6414 | PubChem = 6666 | InChI = 1/C10H8O6S2/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h1-6H,(H,11,12,13)(H,14,15,16) | InChIKey = XTEGVFVZDVNBPF-UHFFFAOYAR | SMILES1 = O=S(=O)(O)c1cccc2c1cccc2S(=O)(=O)O | StdInChI_Ref = | StdInChI = 1S/C10H8O6S2/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h1-6H,(H,11,12,13)(H,14,15,16) | StdInChIKey_Ref = | StdInChIKey = XTEGVFVZDVNBPF-UHFFFAOYSA-N | CASNo_Ref = | CASNo = 81-04-9 | UNII_Ref = | UNII = E8FPK78470 | ChEBI_Ref = | ChEBI = 30890 | SMILES = O=S(C2=CC=CC1=C(S(=O)(O)=O)C=CC=C12)(O)=O | RTECS = |Section2={{Chembox Properties | Formula = C10H8S2O6 | MolarMass = 288.299 g/mol | MeltingPt = | BoilingPt = | Appearance = colorless solid | Density = | Solubility = | pKa = |Section3={{Chembox Structure | MolShape = | Dipole = |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = corrosive |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction_label = | OtherFunction = | OtherCompounds =

Armstrong acid (naphthalene-1,5-disulfonic acid) is a fluorescent organic compound with the formula C10H6(SO3H)2. It is one of several isomers of naphthalenedisulfonic acid. It a colorless solid, typically obtained as the tetrahydrate.

Production and use

It is prepared by disulfonation of naphthalene with oleum: :C10H8 + 2 SO3 → C10H6(SO3H)2 Further sulfonation gives The 1,3,5-trisulfonic acid derivative.

Reactions and uses

Fusion of Armstrong acid in NaOH gives the disodium salt of 1,5-dihydroxynaphthalene, which can be acidified to give the diol. The intermediate in this hydrolysis, 1-hydroxynaphthalene-5-sulfonic acid, is also useful. Nitration gives nitrodisulfonic acids, which are precursors to amino derivatives.

The disodium salt is sometimes used as a divalent counterion for forming salts of basic drug compounds, as an alternative to the related mesylate or tosylate salts. When used in this way such a salt is called a naphthalenedisulfonate salt, as seen with the most common salt form of the stimulant drug CFT. The disodium salt is also used as an electrolyte in certain kinds of chromatography.

References

References

  1. Senning, Alexander. (2007). "Elsevier's dictionary of chemoetymology". Elsevier.
  2. Gerald Booth "Naphthalene Derivatives" in Ullmann's Encyclopedia of Industrial Chemistry, 2005, Wiley-VCH, Weinheim. {{doi. 10.1002/14356007.a17_009.
  3. Shigeru Terabe "Electrokinetic chromatography: An interface between electrophoresis and chromatography" TrAC Trends in Analytical Chemistry 1989, Volume 8, pp. 129–134. {{doi. 10.1016/0165-9936(89)85022-8

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

reagents-for-organic-chemistrynaphthalenesulfonic-acids