Argatroban

Quality 0.50 · 1 view · Updated 2 months ago

Pharmaceutical drug

title: "Argatroban" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["direct-thrombin-inhibitors", "guanidines", "sulfonamides"] description: "Pharmaceutical drug" topic_path: "general/direct-thrombin-inhibitors" source: "https://en.wikipedia.org/wiki/Argatroban" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Pharmaceutical drug ::

| Verifiedfields = changed | verifiedrevid = 457140717 | image = Argatroban.svg | image_class = skin-invert-image | alt =

| pronounce = | tradename = | Drugs.com = | MedlinePlus = | DailyMedID = Argatroban | pregnancy_AU = | pregnancy_AU_comment = | pregnancy_category= | routes_of_administration = Intravenous | class = | ATC_prefix = B01 | ATC_suffix = AE03 | ATC_supplemental =

| legal_AU = | legal_AU_comment = | legal_BR = | legal_BR_comment = | legal_CA = Rx-only | legal_CA_comment = | legal_DE = | legal_DE_comment = | legal_NZ = | legal_NZ_comment = | legal_UK = | legal_UK_comment = | legal_US = Rx-only | legal_US_comment = | legal_EU = | legal_EU_comment = | legal_UN = | legal_UN_comment = | legal_status =

| bioavailability = 100% (intravenous) | protein_bound = 54% | metabolism = hepatic | elimination_half-life = 39 and 51 minutes

| CAS_number_Ref = | CAS_number = 74863-84-6 | PubChem = 440542 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = DB00278 | ChemSpiderID_Ref = | ChemSpiderID = 389444 | UNII_Ref = | UNII = OCY3U280Y3 | KEGG_Ref = | KEGG = C04931 | ChEBI_Ref = | ChEBI = | ChEMBL_Ref = | ChEMBL = 1166 | NIAID_ChemDB = | PDB_ligand = | synonyms =

| IUPAC_name = (2R,4R)-1-[(2S)-5-(diaminomethylideneamino)-2- [[(3R)-3-methyl-1,2,3,4-tetrahydroquinolin-8-yl] sulfonylamino]pentanoyl]-4-methyl-piperidine-2- carboxylic acid | C=23 | H=36 | N=6 | O=5 | S=1 | smiles = O=C(O)[C@@H]3N(C(=O)C(NS(=O)(=O)c1cccc2c1NCC(C2)C)CCC/N=C(\N)N)CCC@@HC3 | StdInChI_Ref = | StdInChI = 1S/C23H36N6O5S/c1-14-8-10-29(18(12-14)22(31)32)21(30)17(6-4-9-26-23(24)25)28-35(33,34)19-7-3-5-16-11-15(2)13-27-20(16)19/h3,5,7,14-15,17-18,27-28H,4,6,8-13H2,1-2H3,(H,31,32)(H4,24,25,26)/t14-,15?,17+,18-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = KXNPVXPOPUZYGB-IOVMHBDKSA-N

Argatroban is an anticoagulant that is a small molecule direct thrombin inhibitor. In 2000, argatroban was licensed by the US Food and Drug Administration (FDA) for prophylaxis or treatment of thrombosis in people with heparin-induced thrombocytopenia (HIT). In 2002, it was approved for use during percutaneous coronary interventions in people who have HIT or are at risk for developing it. In 2012, it was approved by the UK Medicines and Healthcare products Regulatory Agency for anticoagulation in people with heparin-induced thrombocytopenia Type II (HIT) who require parenteral antithrombotic therapy.

Argatroban is given intravenously and drug plasma concentrations reach steady state in 1–3 hours. Argatroban is metabolized in the liver and has a half-life of about 50 minutes. It is monitored by PTT. Because of its hepatic metabolism, it may be used in patients with renal dysfunction. (This is in contrast to lepirudin, a direct thrombin inhibitor that is primarily renally cleared).

Transitioning to warfarin in individuals with heparin-induced thrombocytopenia

Argatroban is used as an anticoagulant in individuals with thrombosis and heparin-induced thrombocytopenia. Often these individuals require long-term anticoagulation. If warfarin is chosen as the long-term anticoagulant, this poses particular challenges due to the falsely elevated prothrombin time and INR caused by argatroban. The combination of argatroban and warfarin may raise the INR to greater than 5.0 without a significant increased risk of bleeding complications. One solution to this problem is to measure the chromogenic factor X level. A level

References

References

  1. (7 July 2016). "Product monograph brand safety updates".
  2. "Argatroban injection, solution".
  3. (2005). "Direct thrombin inhibitors". [[N Engl J Med]].
  4. (3 July 2012). "UK launch for Mitsubishi's blood thinner Exembol".
  5. (2009). "Argatroban: A Review of its Use in the Management of Heparin-Induced Thrombocytopenia". Am J Cardiovasc Drugs.
  6. (2005). "Transitioning from argatroban to warfarin therapy in patients with heparin-induced thrombocytopenia.". Clin Appl Thromb Hemost.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

direct-thrombin-inhibitorsguanidinessulfonamides