Anazocine

Quality 0.50 · 1 view · Updated 2 months ago

Chemical compound

title: "Anazocine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["opioids"] description: "Chemical compound" topic_path: "general/opioids" source: "https://en.wikipedia.org/wiki/Anazocine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| IUPAC_name = 9-Methoxy-3-methyl-9-phenyl-3-azabicyclo[3.3.1]nonane | image = Anazocine structure.svg | image_class = skin-invert-image | CAS_number = 15378-99-1 | CAS_supplemental = 21650-02-2 (citrate) | UNII_Ref = | UNII = K2S5VMM2SG | ATC_prefix = None | ATC_suffix = | PubChem = 27213 | ChemSpiderID = 25327 | ChEMBL = 2105792 | C = 16 | H = 23 | N = 1 | O = 1 | smiles = O(C2(c1ccccc1)C3CCCC2CN(C3)C)C | StdInChI = 1S/C16H23NO/c1-17-11-14-9-6-10-15(12-17)16(14,18-2)13-7-4-3-5-8-13/h3-5,7-8,14-15H,6,9-12H2,1-2H3 | StdInChIKey = YFFNPIAPUDUYAU-UHFFFAOYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = | routes_of_administration =

Anazocine (INN; also known as azabicyclane or CS-307) is an opioid analgesic of the morphan/benzomorphan family developed in the middle 1960s in the United States which was never marketed. It is listed by some sources as a teratogen.

The structure and properties of several related α- and β-azabicyclane opioids was explored. Anazocine's chemical and structural relatives include opioid partial agonists, mixed agonist-antagonists, pure agonists, antagonists, and atypical non-opioid analgesics. It was tested in pigeons and in other experiments which contrasted and compared its analgesic effects to those of the phenazepine opioid ethoheptazine and the phenalkoxam open chain opioid propoxyphene, and pethidine as well.

References

References

  1. (1997). "Dictionary of Pharmacological Agents". CRC Press.
  2. (September 1970). "The pharmacology of azabicyclane, a new analgesic agent". Toxicology and Applied Pharmacology.
  3. "Teratogens". Purdue University.
  4. (1984). "Conformational properties of α- and β-azabicyclane opiates. The effect of conformation on pharmacological activity". Journal of Computational Chemistry.
  5. (September 1970). "The pharmacology of azabicyclane, a new analgesic agent". Toxicology and Applied Pharmacology.
  6. (1979). "Effects of propoxyphene, ethoheptazine, and azabicyclane on schedule-controlled responding: attenuation by pentobarbital but not naloxone". Psychopharmacology.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

opioids