Allobarbital

Chemical compound
title: "Allobarbital" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["barbiturates", "allyl-compounds"] description: "Chemical compound" topic_path: "general/barbiturates" source: "https://en.wikipedia.org/wiki/Allobarbital" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| verifiedrevid = 477317940 | IUPAC_name = 5,5-di(prop-2-en-1-yl)-1,3-diazinane-2,4,6-trione | image = Allobarbital.svg | image_class = skin-invert-image | width = 120 | image2 = Allobarbital ball-and-stick animation.gif | image_class2 = bg-transparent | width2 = 160 | tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_BR = B1 | legal_BR_comment = | legal_CA = Schedule IV | legal_UK = | legal_US = Schedule III | legal_DE = Anlage III | legal_status = | routes_of_administration = | class = Barbiturate | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref = | CAS_number = 52-43-7 | ATC_prefix = N05 | ATC_suffix = CA21 | PubChem = 5842 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 5635 | UNII_Ref = | UNII = 8NT43GG2HA | KEGG_Ref = | KEGG = D02817 | ChEMBL_Ref = | ChEMBL = 267719 | C=10 | H=12 | N=2 | O=3 | smiles = O=C1NC(=O)NC(=O)C1(C\C=C)C\C=C | StdInChI_Ref = | StdInChI = 1S/C10H12N2O3/c1-3-5-10(6-4-2)7(13)11-9(15)12-8(10)14/h3-4H,1-2,5-6H2,(H2,11,12,13,14,15) | StdInChIKey_Ref = | StdInChIKey = FDQGNLOWMMVRQL-UHFFFAOYSA-N | synonyms = 5,5-Diallylbarbituric acid, Diallylmalonylurea Allobarbital, also known as allobarbitone and branded as Dial, Cibalgine (in combination with aminophenazone), or Dial-Ciba (in combination with ethyl carbamate), is a barbiturate derivative invented in 1912 by Ernst Preiswerk and Ernst Grether working for CIBA. It was used primarily as an anticonvulsant although it has now largely been replaced by newer drugs with improved safety profiles. Other uses for allobarbital included as an adjutant to boost the activity of analgesic drugs, and use in the treatment of insomnia and anxiety.
Allobarbital was never particularly widely used compared to better known barbiturates such as phenobarbital and secobarbital, although it saw more use in some European countries such as Bulgaria and Slovakia. In Poland, it was used until the 2010's, but only as compound.
References
References
- Anvisa. (2023-03-31). "RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial". [[Diário Oficial da União]].
- (1971). "Effect of allobarbital on focal epilepsy in rats". Physiologia Bohemoslovaca.
- (1987). "GABA-ergic mechanisms in the anticonvulsive activity of newly-synthesized barbiturates. I. Effects of barbiturates on the convulsive action of GABA-antagonists". Acta Physiologica et Pharmacologica Bulgarica.
- "APTECZKA BABUNI - KROPLE ŻOŁĄDKOWE KROPLE 20 G".
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::