4-Methylcatechol
.mw-parser-output .ib-chembox{border-collapse:collapse;text-align:left}.mw-parser-output .ib-chembox td,.mw-parser-output .ib-chembox th{border:1px solid #a2a9b1;width:40%}.mw-parser-output .ib-chembox td+td{width:60%}@media screen{html.skin-theme-clientpref-night .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}@media screen and (prefers-color-scheme:dark){html.skin-theme-clientpref-os .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}
.mw-parser-output .ib-chembox{border-collapse:collapse;text-align:left}.mw-parser-output .ib-chembox td,.mw-parser-output .ib-chembox th{border:1px solid #a2a9b1;width:40%}.mw-parser-output .ib-chembox td+td{width:60%}@media screen{html.skin-theme-clientpref-night .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}@media screen and (prefers-color-scheme:dark){html.skin-theme-clientpref-os .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}
| Column 1 | Column 2 |
|---|---|
| Preferred IUPAC name | |
| 4-Methylbenzene-1,2-diol | |
| Other names | |
| 4-Methyl-1,2-dihydroxybenzene3,4-DihydroxytolueneHomocatechol4-Methyl-1,2-benzenediolHomopyrocatecholp-Methylcatechol | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}452-86-8 Y |
| 3D model (JSmol) | Interactive image |
| ChEBI | CHEBI:17254 |
| ChEMBL | ChEMBL158766 |
| ChemSpider | 9564 |
| DrugBank | DB04120 |
| ECHA InfoCard | 100.006.559 |
| EC Number | 207-214-5 |
| KEGG | C06730 |
| PubChem CID | 9958 |
| UNII | 12GLI7JGB3 Y |
| CompTox Dashboard (EPA) | DTXSID5020861 |
| InChI | |
| InChI=1S/C7H8O2/c1-5-2-3-6(8)7(9)4-5/h2-4,8-9H,1H3Key: ZBCATMYQYDCTIZ-UHFFFAOYSA-N | |
| SMILES | |
| CC1=CC(=C(C=C1)O)O | |
| Chemical formula | C7H8O2 |
| Molar mass | 124.139 g·mol−1 |
| GHS labelling:[1] | |
| Pictograms | |
| Signal word | Warning |
| Hazard statements | H302, H312, H315, H319, H335 |
| Precautionary statements | P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, P501 |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references | |
4-Methylcatechol is an organic compound with the formula .mw-parser-output .template-chem2-su{display:inline-block;font-size:80%;line-height:1;vertical-align:-0.35em}.mw-parser-output .template-chem2-su>span{display:block;text-align:left}.mw-parser-output sub.template-chem2-sub{font-size:80%;vertical-align:-0.35em}.mw-parser-output sup.template-chem2-sup{font-size:80%;vertical-align:0.65em}CH3C6H3(OH)2 A white solid, it is one of the isomers of methylbenzenediol.
The enzyme cis-1,2-dihydroxy-4-methylcyclohexa-3,5-diene-1-carboxylate dehydrogenase uses cis-1,2-dihydroxy-4-methylcyclohexa-3,5-diene-1-carboxylate and NAD(P)+ to produce 4-methylcatechol, NADH, NADPH and CO2.
Members of the monocot subfamily Amaryllidoideae present a unique type of alkaloids, the norbelladine alkaloids, which are 4-methylcatechol derivatives combined with tyrosine. They are responsible for the poisonous properties of a number of the species. Over 200 different chemical structures of these compounds are known, of which 79 or more are known from Narcissus alone.
Calone, a derivative of 4-methylcatechol, is known in the fragrance industry as "watermelon ketone" for its distinctive odor.
The brand of low-temperature coke used as a smokeless fuel Coalite obtains homocatechol from ammoniacal liquor by solvent extraction, distillation and crystallisation.
Being structurally related to lignans, it is contributes to the aerosol generate by combustion of wood.
It is a component of castoreum, the exudate from the castor sacs of the mature beaver.
- Dihydroxytoluene