4-AcO-MiPT

---

title: "4-AcO-MiPT" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["acetate-esters", "4-acyloxytryptamines", "designer-prodrugs", "n,n-dialkyltryptamines", "entheogens", "psychedelic-tryptamines"] description: "Psychedelic drug" topic_path: "general/acetate-esters" source: "https://en.wikipedia.org/wiki/4-AcO-MiPT" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Psychedelic drug ::

::data[format=table title="Infobox drug"]

Field	Value
Verifiedfields	changed
Watchedfields	changed
verifiedrevid	477345104
image	4-Acetoxy-MiPT.svg
image_class	skin-invert-image
width	200px
image2	4-Acetoxy-MiPT 3D.png
image_class2	bg-transparent
width2	225px
CAS_number_Ref
CAS_number	1024612-25-6
PubChem	46783587
ChemSpiderID_Ref
ChemSpiderID	23976075
UNII_Ref
UNII	SS93IMV779
synonyms	4-Acetoxy-N-methyl-N-isopropyltryptamine; Mipracetin
IUPAC_name	3-{2-[methyl(propan-2-yl)amino]ethyl}-1H-indol-4-yl acetate
C	16
SMILES	CC(N(CCC1=CNC2=C1C(OC(C)=O)=CC=C2)C)C
StdInChI_Ref
StdInChI	1S/C16H22N2O2/c1-11(2)18(4)9-8-13-10-17-14-6-5-7-15(16(13)14)20-12(3)19/h5-7,10-11,17H,8-9H2,1-4H3
StdInChIKey_Ref
StdInChIKey	CIDMXLOVFPIHDS-UHFFFAOYSA-N
::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477345104 | drug_name = | image = 4-Acetoxy-MiPT.svg | image_class = skin-invert-image | width = 200px | caption = | image2 = 4-Acetoxy-MiPT 3D.png | image_class2 = bg-transparent | width2 = 225px | caption2 =

| pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = | class = | ATC_prefix = | ATC_suffix =

| legal_status =

| bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =

| CAS_number_Ref = | CAS_number = 1024612-25-6 | CAS_supplemental = | PubChem = 46783587 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 23976075 | UNII_Ref = | UNII = SS93IMV779 | KEGG = | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms = 4-Acetoxy-N-methyl-N-isopropyltryptamine; Mipracetin

| IUPAC_name = 3-{2-[methyl(propan-2-yl)amino]ethyl}-1H-indol-4-yl acetate | C=16 | H=22 | N=2 | O=2 | SMILES = CC(N(CCC1=CNC2=C1C(OC(C)=O)=CC=C2)C)C | StdInChI_Ref = | StdInChI = 1S/C16H22N2O2/c1-11(2)18(4)9-8-13-10-17-14-6-5-7-15(16(13)14)20-12(3)19/h5-7,10-11,17H,8-9H2,1-4H3 | StdInChIKey_Ref = | StdInChIKey = CIDMXLOVFPIHDS-UHFFFAOYSA-N

4-AcO-MiPT, also known as 4-acetoxy-N-methyl-N-isopropyltryptamine or as mipracetin, is a psychedelic tryptamine. It is closely related to 4-AcO-DMT and methylisopropyltryptamine (MiPT).

There is very little information on the human pharmacology or toxicity of 4-AcO-MiPT, although analytical methods have been developed for its detection.

Use and effects

Interactions

Chemistry

Analogues of 4-AcO-MiPT include methylisopropyltryptamine (MiPT), 4-HO-MiPT (miprocin), 5-MeO-MiPT, 4-AcO-DMT (psilacetin), 4-AcO-MET (metacetin), 4-AcO-MPT, 4-AcO-MALT, and 4-AcO-DiPT (ipracetin), among others.

Society and culture

Legal status

Canada

4-AcO-MiPT is not a controlled substance in Canada as of 2025.

Sweden

Sveriges riksdags health ministry Statens folkhälsoinstitut classified 4-AcO-MiPT as "health hazard" under the act Lagen om förbud mot vissa hälsofarliga varor (translated Act on the Prohibition of Certain Goods Dangerous to Health) as of Nov 1, 2005, in their regulation SFS 2005:733 listed as 4-acetoxi-N,N-metylisopropyltryptamin (4-AcO-MIPT), making it illegal to sell or possess.

United States

4-AcO-MiPT is not an explicitly controlled substance in the United States. However, it could be considered a controlled substance under the Federal Analogue Act if intended for human consumption.

References

References

1. (February 2009). "Creation and application of psychoactive designer drugs data library using liquid chromatography with photodiode array spectrophotometry detector and gas chromatography-mass spectrometry". Talanta.
2. (20 September 2011). "Application of GA–KPLS and L–M ANN calculations for the prediction of the capacity factor of hazardous psychoactive designer drugs". Medicinal Chemistry Research.
3. "Controlled Drugs and Substances Act".
4. (6 October 2005). "Förordning om ändring i förordningen (1999:58) om förbud mot vissa hälsofarliga varor".
5. (January 2026). "Orange Book: List of Controlled Substances and Regulated Chemicals (January 2026)". U.S. [[Department of Justice]]: [[Drug Enforcement Administration]] (DEA): Diversion Control Division.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::