4-AcO-DET

Chemical compound


title: "4-AcO-DET" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["5-ht1a-agonists", "5-ht2a-agonists", "5-ht2c-agonists", "acetate-esters", "4-acyloxytryptamines", "designer-prodrugs", "n,n-dialkyltryptamines", "diethylamino-compounds", "psychedelic-tryptamines", "substances-discovered-in-the-1950s", "tihkal"] description: "Chemical compound" topic_path: "general/5-ht1a-agonists" source: "https://en.wikipedia.org/wiki/4-AcO-DET" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477220842 | image = 4-AcO-DET.svg | image_class = skin-invert-image | width = 225px | image2 = 4-Acetoxy-N,N-diethyltryptamine.png | image_class2 = bg-transparent | width2 = 225px

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | routes_of_administration = Oral | class = Serotonergic psychedelic; Hallucinogen | ATC_prefix = None | ATC_suffix =

| legal_AU = | legal_CA = | legal_DE = NpSG | legal_UK = Class A | legal_US = | legal_status =

| bioavailability = | protein_bound = | metabolism = | onset = | elimination_half-life = | duration_of_action = 4–6 hours | excretion =

| CAS_number_Ref = | CAS_number = 1135424-15-5 | UNII_Ref = | UNII = 43U8799479 | PubChem = 24801867 | ChemSpiderID_Ref = | ChemSpiderID = 21106239 | synonyms = 4-Acetoxy-DET; 4-Acetoxy-N,N-diethyltryptamine; Ethacetin; Ethylacybin

| IUPAC_name = 3-(2-diethylaminoethyl)-1H-indol-4-yl acetate | C=16 | H=22 | N=2 | O=2 | SMILES = CC(OC1=CC=CC2=C1C(CCN(CC)CC)=CN2)=O | StdInChI_Ref = | StdInChI = 1S/C16H22N2O2/c1-4-18(5-2)10-9-13-11-17-14-7-6-8-15(16(13)14)20-12(3)19/h6-8,11,17H,4-5,9-10H2,1-3H3 | StdInChIKey_Ref = | StdInChIKey = ODVLAYUXIAMBFN-UHFFFAOYSA-N

4-AcO-DET, also known as 4-acetoxy-N,N-diethyltryptamine as well as ethacetin or ethylacybin, is a psychedelic tryptamine. It was first synthesized in 1958 by Albert Hofmann in the Sandoz lab.

Use and effects

4-AcO-DET is orally active, and doses of 10 to 25mg are common. Effects last 4 to 6hours. The free base is also active when smoked in a dose range of 5 to 20mg. Smoking 4-AcO-DET greatly speeds up the onset; peak effects are experienced within 10minutes, and are usually over within 1 hour.

Interactions

Pharmacology

It is expected that 4-AcO-DET is quickly hydrolyzed into the free phenolic 4-HO-DET by serum esterases, but human studies concerning the metabolic fate of this drug are lacking.

Chemistry

Analogues

Analogues of 4-AcO-DET include diethyltryptamine (DET), 4-HO-DET (ethocin), ethocybin (4-PO-DET), 4-AcO-DMT (psilacetin), 4-AcO-DPT, 4-AcO-MET, and 4-AcO-MPT, among others.

Society and culture

Legal status

Canada

4-AcO-DET is not an explicitly nor implicitly controlled substance in Canada as of 2025.

Finland

Listed in the "government decree on psychoactive substances banned from the consumer market".

Sweden

Sveriges riksdags health ministry Statens folkhälsoinstitut classified 4-AcO-DET as "health hazard" under the act Lagen om förbud mot vissa hälsofarliga varor (translated Act on the Prohibition of Certain Goods Dangerous to Health) as of Nov 1, 2005, in their regulation SFS 2005:733 listed as 4-acetoxi-N,N-dietyltryptamin (4-AcO-DET), making it illegal to sell or possess.

United States

4-AcO-DET is not an explicitly controlled substance in the United States. However, it could be considered a controlled substance under the Federal Analogue Act if intended for human consumption.

References

References

  1. [http://www.erowid.org/chemicals/4_acetoxy_det/4_acetoxy_det_primer.shtml Erowid 4-Acetoxy-DET Vaults : Primer]. Accessed on April 19, 2007.
  2. "#16. 4-HO-DET". Tikhal: The Chemistry Continues.
  3. (5 December 2025). "Controlled Drugs and Substances Act".
  4. "Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista".
  5. Svensk författningssamling. (13 October 2005). "Förordning om ändring i förordningen (1999:58) om förbud mot vissa hälsofarliga varor;".
  6. (January 2026). "Orange Book: List of Controlled Substances and Regulated Chemicals (January 2026)". U.S. [[Department of Justice]]: [[Drug Enforcement Administration]] (DEA): Diversion Control Division.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

5-ht1a-agonists5-ht2a-agonists5-ht2c-agonistsacetate-esters4-acyloxytryptaminesdesigner-prodrugsn,n-dialkyltryptaminesdiethylamino-compoundspsychedelic-tryptaminessubstances-discovered-in-the-1950stihkal