2-Heptanol
2-Heptanol is a chemical compound which is an isomer of heptanol. It is a secondary alcohol with the hydroxyl on the second carbon of the straight seven-carbon chain. The compound is flammable and irritant, and through inhalation, ingestion or though skin it can enter into the body.
.mw-parser-output .ib-chembox{border-collapse:collapse;text-align:left}.mw-parser-output .ib-chembox td,.mw-parser-output .ib-chembox th{border:1px solid #a2a9b1;width:40%}.mw-parser-output .ib-chembox td+td{width:60%}@media screen{html.skin-theme-clientpref-night .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}@media screen and (prefers-color-scheme:dark){html.skin-theme-clientpref-os .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}
| Column 1 | Column 2 |
|---|---|
| Preferred IUPAC name | |
| Heptan-2-ol | |
| Other names | |
| s-Heptyl alcohol | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}543-49-7 Y |
| 3D model (JSmol) | Interactive image |
| ChEBI | CHEBI:88815 |
| ChEMBL | ChEMBL449522 Y |
| ChemSpider | 10511 Y |
| ECHA InfoCard | 100.008.041 |
| PubChem CID | 10976 |
| UNII | E12FIG07JK Y |
| CompTox Dashboard (EPA) | DTXSID1047158 |
| InChI | |
| InChI=1S/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3 YKey: CETWDUZRCINIHU-UHFFFAOYSA-N YInChI=1/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3Key: CETWDUZRCINIHU-UHFFFAOYAL | |
| SMILES | |
| OC(C)CCCCC | |
| Chemical formula | C7H16O |
| Molar mass | 116.204 g·mol−1 |
| Density | 0.817 g/mL |
| Melting point | −30.2 °C (−22.4 °F; 243.0 K) |
| Boiling point | 159 °C (318 °F; 432 K) |
| Solubility in water | 3.3 g/L |
| Solubility | soluble in ethanol, diethyl ether |
| Viscosity | 3.955 mPa·s |
| Flash point | 71 °C (160 °F; 344 K) |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
| Y verify (what is YN ?) |
Infobox references | |
2-Heptanol is a chemical compound which is an isomer of heptanol. It is a secondary alcohol with the hydroxyl on the second carbon of the straight seven-carbon chain. The compound is flammable and irritant, and through inhalation, ingestion or though skin it can enter into the body.
2-Heptanol is chiral, so (R)- and (S)-isomers exist.
- 1-Heptanol
- 3-Heptanol
- 4-Heptanol
.mw-parser-output .reflist-columns-2{column-width:30em}.mw-parser-output .reflist-columns-3{column-width:25em}body.skin-vector-2022 .mw-parser-output .reflist-columns-2{column-width:27em}body.skin-vector-2022 .mw-parser-output .reflist-columns-3{column-width:22.5em}.mw-parser-output .references[data-mw-group=upper-alpha]{list-style-type:upper-alpha}.mw-parser-output .references[data-mw-group=upper-roman]{list-style-type:upper-roman}.mw-parser-output .references[data-mw-group=lower-alpha]{list-style-type:lower-alpha}.mw-parser-output .references[data-mw-group=lower-greek]{list-style-type:lower-greek}.mw-parser-output .references[data-mw-group=lower-roman]{list-style-type:lower-roman}.mw-parser-output div.reflist-liststyle-upper-alpha .references{list-style-type:upper-alpha}.mw-parser-output div.reflist-liststyle-upper-roman .references{list-style-type:upper-roman}.mw-parser-output div.reflist-liststyle-lower-alpha .references{list-style-type:lower-alpha}.mw-parser-output div.reflist-liststyle-lower-greek .references{list-style-type:lower-greek}.mw-parser-output div.reflist-liststyle-lower-roman .references{list-style-type:lower-roman}
.mw-parser-output .asbox{position:relative;overflow:hidden}.mw-parser-output .asbox table{background:transparent}.mw-parser-output .asbox p{margin:0}.mw-parser-output .asbox p+p{margin-top:0.25em}.mw-parser-output .asbox-body{font-style:italic}.mw-parser-output .asbox-note{font-size:smaller}.mw-parser-output .asbox .navbar{position:absolute;top:-0.75em;right:1em;display:none}.mw-parser-output :not(p):not(.asbox)+style+.asbox,.mw-parser-output :not(p):not(.asbox)+link+.asbox{margin-top:3em}